AMBIENT

Giải Hóa 12 SGK nâng cao Chương 1 Bài 4 Luyện tập

Dưới đây là Hướng dẫn giải bài tập Hóa 12 nâng cao Chương 1 Bài 4 Luyện tập được hoc247 biên soạn và tổng hợp, nội dung bám sát theo chương trình SGK Hóa học 12 nâng cao giúp các em học sinh nắm vững phương pháp giải bài tập và ôn tập kiến thức hiệu quả hơn. 

Bài 1 trang 22 SGK Hóa 12 nâng cao

Nguyên liệu cho công nghiệp hóa chất hữu cơ ngày nay dựa chủ yếu vào :

A. khí thiên nhiên

B. than đá và đá vôi

C. thực vật

D. dầu mỏ

Hướng dẫn giải:

Đáp án D


Bài 2 trang 22 SGK Hóa 12 nâng cao

a. Vì sao trong sơ đồ mối liên hệ giữa hidrocacbon và dẫn xuất chứa oxi, ankan lại được đặt ở trung tâm ?

b. Xuất phát từ ô trung tâm lần lượt điền vào đó metan, etan và n-hexan rồi viết phương trình phản ứng (nếu có) theo các mũi tên đã chỉ để đi đến các ô khác trong sơ đồ ( “dạo quanh sơ đồ”)

c. Hãy thử tìm một hidrocacbon no để từ đó đi theo hết mọi mũi tên đến hết mọi ô của sơ đồ

Hướng dẫn giải:

Câu a:

Ankan được đặt ở trung tâm của sơ đồ do ankan là nguyên liệu chính để tổng hợp ra các hidrocacbon khác và dẫn xuất có oxi của chúng.

Câu b:

Sơ đồ của metan

Sơ đồ và phản ứng của metan

1. CH4 + Cl2 → CH3Cl + HCl   (đk : ánh sáng)

2. CH3Cl + H2O → CH3OH + HCl (đk: OH-, to)

3. CH3OH + HCl → CH3Cl + H2O

4. CH3OH + CuO → HCHO + Cu + H2O  (đk: nhiệt độ)

5. HCHO + H2 → CH3OH  (xt: Ni, to)

6. HCHO + [O] → HCOOH (xt: KMnO4)

7. HCOOH + ROH → HCOOR + H2O   (xt: H2SO4,to)

8. HCOOR + H2O  → HCOOH + ROH (xt: H+, to)

9. 2CH4 → C2H2+ 3H2 ( làm lạnh nhanh, 1500oC)

10. C2H2 + H2O  → CH3CHO  (xt: Hg2+, to)

11. CH3CHO + [O] → CH3COOH (xt: KMnO4)

Sơ đồ và phản ứng của etan

1. C2H6 → C2H4 + H2  (xt, to)

2. C2H4 + H2 → C2H6  (xt: Ni, to)

3. C2H6 → C2H2 + 2H2   (xt, to)

4. C2H2 + 2H2 → C2H6  (Ni, to)

5. C2H6 + Cl2 → C2H5Cl + HCl  (đk: ánh sáng)

6. C2H4 + HCl  → C2H5Cl

7. C2H5Cl + KOH → C2H4 + KCl + H2O   (xt: ancol)

8. C2H2 + H2 → C2H4 (xt: Pd/PbCO3)

9. C2H5Cl + HOH → C2H5OH + HCl  (xt: OH-, to)

10. C2H5OH + HCl → C2H5Cl + H2O

11. C2H5OH + CuO → CH3CHO + Cu + H2O  (đk: nhiệt độ).

12. CH3CHO + H2 → CH3CH2OH ( xt: Ni, to)

13. C2H2 + HOH  → CH3CHO  (xt: Hg2+, to)

14. CH3CHO + [O] → CH3COOH  (xt: KMnO4)

15. CH3COOH + ROH ⇔ CH3COOR + H2O  (xt: H2SO4, to)

16. CH3COOR + H2O ⇔ CH3COOH + ROH  (xt: H+)


Bài 3 trang 22 SGK Hóa 12 nâng cao

Hãy dùng sơ đồ phản ứng chứng tỏ rằng từ metan có thể tổng hợp được các ancol, andehit và axit có từ 1 đến 2 nguyên tử C trong phân tử

Hướng dẫn giải:

Từ metan tổng hợp các ancol, andehit và axit có từ 1 đến 2 nguyên tử C trong phân tử


Bài 4 trang 23 SGK Hóa 12 nâng cao

Hãy viết sơ đồ phản ứng từ etilen và toluen điều chế ra các hợp chất sau

a) Etyl benzoat

b) 1-Etyl-4-metylbenzen

c) Benzyl axetat

Hướng dẫn giải:

Câu a:

etyl benzoat: C6H5COOC2H5

Câu b:

1-etyl-4-metylbenzen

Câu c:

benzyl axetat


Bài 5 trang 23 SGK Hóa 12 nâng cao

Hãy viết sơ đồ phản ứng từ etilen và toluen điều chế ra các hợp chất sau:

a. Chúng thuộc chức hữu cơ nào?

b. Hãy viết công thức cấu tạo thu gọn và công thức phân tử của chúng

c. Gọi tên hai hợp chất đầu theo danh pháp IUPAC

Hướng dẫn giải:

Câu a:

Xitronelal và geranial thuộc chức andehit do phân tử có chứa nhóm chức –CH=O. Metol thuộc chức rượu (ancol) vì phân tử có chứa nhóm –OH

Câu b:

Công thức cấu tạo thu gọn và công thức phân tử :

Xitronelal CH3C(CH3)=CHCH2CH2CH(CH3)CH2CHO : C10H18O

Geranial CH3C(CH3)=CHCH2CH2C(CH3)=CHCHO : C10H16O

Metol

Câu c:

Tên của xitronelal và geranial theo IUPAC

Xitronelal : 3,7-dimetyl oct-6-en-1-al

Geranial : 3,7-dimetyl oct-2,6-dien-1-al


Bài 6 trang 23 SGK Hóa 12 nâng cao

Hãy hoàn thành các sơ đồ phản ứng sau :

Hướng dẫn giải:

Câu a:

Các phương trình phản ứng

Câu b:

Các phương trình phản ứng


Bài 7 trang 23 SGK Hóa 12 nâng cao

Đun nóng 3,21 gam hỗn hợp A gồm hai chất hữu cơ B và C có cùng nhóm chức với dung dịch NaOH dư thu được hỗn hợp muối natri của hai axit no đơn chức kế tiếp nhau trong dãy đồng đẳng và một chất lỏng D. Chất D phản ứng với CuO đun nóng cho sản phẩm có phản ứng tráng gương. Cho 1/10 lượng chất D phản ứng với natri được 33,6 ml H2 (đktc). Tỉ khối hơi của D so với không khí là 2

a. Xác định công thức cấu tạo của B, C và D

b. Tính thành phần % khối lượng hỗn hợp A

c. Viết phương trình phản ứng của B hoặc C với H2 (Ni, to) , Brvà phản ứng tạo thành polime của chúng

Hướng dẫn giải:

Câu a:

Hai chất hữu cơ cùng chức tác dụng với NaOH dư tạo ra 2 muối natri của 2 axit no đơn chức kế tiếp và một chất lỏng D.

D + CuO → Sản phẩm có tráng bạc

Do đó D là ancol bậc 1 : R–CH2OH

B và C là 2 este tạo bởi 2 axit no, đơn chức kế tiếp nhau có công thức chung là CnH2n+1COOH và ancol D.

- Tìm ancol D : dd/kk = 2 → MD = 29.2 = 58

R’ + 14 + 17 = 58 → R’ = 27 (C2H3)

D là C3H5OH: CH2=CH-CH2OH (ancol anlylic)

- Tìm B, C: Đặt công thức chung cho B và C là CnH2n+1COOC3H5

Các phương trình phản ứng :

CnH2n+1COOC3H5 + NaOH → CnH2n+1COONa + C3H5OH (1)

C3H5OH + Na → C3H5ONa + 1/2 H(bay hơi) (2)

Số mol H2 = 0,0366 : 22,4 = 0,0015

Vậy 1:10 số mol D là nC3H5OH = 2.0,0015 = 0,003 mol

Theo (1) số mol este CnH2n+1COOC3H5 bằng số mol ancol trong cả lượng D:

neste = 10.0,003 = 0,03 mol

\( \to Meste = \frac{m}{n} = \frac{{3,21}}{{0,03}} = 107\)

14n + 1 + 44 + 41 = 107 ⇒ n = 1,5

Vậy 2 axit kế tiếp là CH3COOH và C2H5COOH, hai este là CH3COOC3H5 và C2H5COOC3H5

Cấu tạo của 2 este :

CH3COOCH2CH=CH2 (M = 100; x mol)

CH3CH2COOCH2CH=CH2 (M = 114; y mol)

Câu b:

Tính % (m)

Theo bài ta có hệ pt:

\(\left\{ \begin{array}{l}
x + y = 0,03mol\\
100x + 114y = 3,21
\end{array} \right.\)

⇒ x = y = 0,015 mol

%(m) CH3COOC3H5 = (0,015.100:3,21).100% = 46,73 %

%(m) C2H5COOC3H5 = 53,27%

Câu c:

Phương trình phản ứng của một este với H2, Br2 và tạo polime


Bài 8 trang 23 SGK Hóa 12 nâng cao

Hãy phân tích các chất vào các loại sau (một chất có thể thuộc nhiều loại)

A. Chất béo  a, CH3[CH2]14COOCH2[CH2]28CH3
B. Chất giặt rửa b, CH3[CH2]14COONa
C. Este c, CH3[CH2]14CH2OSO3Na
D. Lipit d, CH3COOCH2CH(OOCCH3)CH2OCOCH3
  e, CH3[CH2]14COOCH2CH(OCO[CH2]16CH3)CH2OCO[CH2]14CH3

Hướng dẫn giải:

A. Chất béo : e

B. Chất giặt rửa : b,c

C. Este : a, d, e

D. Lipit : e


Bài 9 trang 24 SGK Hóa 12 nâng cao

Chỉ số xà phóng hóa của chất béo là số mg KOH cần để xà phòng hóa triglixerit và trung hòa axit béo tự do trong một gam chất béo (tức xà phòng hóa hoàn toàn 1 gam chất béo).Hãy tính chỉ số xà phòng hóa của một chất béo, biết rằng khi xà phòng hóa hoàn toàn 1,5 gam chất béo đó cần 50 ml dung dịch KOH 0,1 M

Hướng dẫn giải:

nKOH = 0,05.0,1 = 0,005 (mol)

⇒ mKOH = 0,005. 56 = 0,28 g = 280 (mg)

Xà phòng hóa 1,5 gam chất béo cần 280 mg KOH do đó xà phòng hóa 1 gam chất béo cần 186,7 mg KOH. Vậy chỉ số xà phòng là 186,7.

 

Trên đây là nội dung chi tiết giải bài tập SGK nâng cao môn Hóa 12 Chương 1 bài Luyện tập, với hướng dẫn giải chi tiết, rõ ràng, trình bày khoa học. Hoc247 hy vọng đây sẽ là tài liệu hữu ích giúp các bạn học sinh lớp 12 học tập thật tốt!

 

YOMEDIA